C12H16N4O4 — CID 9196665
[2-[[(2R)-1-(ethylamino)-1-oxopropan-2-yl]amino]-2-oxoethyl] pyrazine-2-carboxylate (PubChem CID 9196665) has the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is [2-[[(2R)-1-(ethylamino)-1-oxopropan-2-yl]amino]-2-oxoethyl] pyrazine-2-carboxylate.
| Compound Name | [2-[[(2R)-1-(ethylamino)-1-oxopropan-2-yl]amino]-2-oxoethyl] pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 9196665 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | [2-[[(2R)-1-(ethylamino)-1-oxopropan-2-yl]amino]-2-oxoethyl] pyrazine-2-carboxylate |
| SMILES | CCNC(=O)[C@@H](C)NC(=O)COC(=O)c1cnccn1 |
| InChI | InChI=1S/C12H16N4O4/c1-3-14-11(18)8(2)16-10(17)7-20-12(19)9-6-13-4-5-15-9/h4-6,8H,3,7H2,1-2H3,(H,14,18)(H,16,17)/t8-/m1/s1 |
| InChIKey | NQLJYTYSKYMLKY-MRVPVSSYSA-N |
| XLogP | -0.73 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |