C10H10N4O3 — CID 7985513
[2-(2-cyanoethylamino)-2-oxoethyl] pyrazine-2-carboxylate (PubChem CID 7985513) has the molecular formula C10H10N4O3 and a molecular weight of 234.22 g/mol. Its IUPAC name is [2-(2-cyanoethylamino)-2-oxoethyl] pyrazine-2-carboxylate.
| Compound Name | [2-(2-cyanoethylamino)-2-oxoethyl] pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 7985513 |
| Molecular Formula | C10H10N4O3 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | [2-(2-cyanoethylamino)-2-oxoethyl] pyrazine-2-carboxylate |
| SMILES | N#CCCNC(=O)COC(=O)c1cnccn1 |
| InChI | InChI=1S/C10H10N4O3/c11-2-1-3-14-9(15)7-17-10(16)8-6-12-4-5-13-8/h4-6H,1,3,7H2,(H,14,15) |
| InChIKey | IEOOWNHJMPPYJZ-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|