C23H28N2O — CID 42943354
N-[[2-[4-[(dimethylamino)methyl]phenyl]phenyl]methyl]cyclohex-3-ene-1-carboxamide (PubChem CID 42943354) has the molecular formula C23H28N2O and a molecular weight of 348.49 g/mol. Its IUPAC name is N-[[2-[4-[(dimethylamino)methyl]phenyl]phenyl]methyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | N-[[2-[4-[(dimethylamino)methyl]phenyl]phenyl]methyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 42943354 |
| Molecular Formula | C23H28N2O |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | N-[[2-[4-[(dimethylamino)methyl]phenyl]phenyl]methyl]cyclohex-3-ene-1-carboxamide |
| SMILES | CN(C)Cc1ccc(-c2ccccc2CNC(=O)C2CC=CCC2)cc1 |
| InChI | InChI=1S/C23H28N2O/c1-25(2)17-18-12-14-19(15-13-18)22-11-7-6-10-21(22)16-24-23(26)20-8-4-3-5-9-20/h3-4,6-7,10-15,20H,5,8-9,16-17H2,1-2H3,(H,24,26) |
| InChIKey | WWVPITBZNGBYGQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|