C15H7ClF16N2O — CID 3484227
9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-N-(pyridin-2-ylmethyl)nonanamide (PubChem CID 3484227) has the molecular formula C15H7ClF16N2O and a molecular weight of 570.66 g/mol. Its IUPAC name is 9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-N-(pyridin-2-ylmethyl)nonanamide.
| Compound Name | 9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-N-(pyridin-2-ylmethyl)nonanamide |
|---|---|
| PubChem CID | 3484227 |
| Molecular Formula | C15H7ClF16N2O |
| Molecular Weight | 570.66 g/mol |
| Exact Mass | 570.00 |
| IUPAC Name | 9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluoro-N-(pyridin-2-ylmethyl)nonanamide |
| SMILES | O=C(NCc1ccccn1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C15H7ClF16N2O/c16-15(31,32)14(29,30)13(27,28)12(25,26)11(23,24)10(21,22)9(19,20)8(17,18)7(35)34-5-6-3-1-2-4-33-6/h1-4H,5H2,(H,34,35) |
| InChIKey | YPWGZKANHIQCEC-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.66 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|