C17H14F3NO4 — CID 46613009
N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-(trifluoromethoxy)benzamide (PubChem CID 46613009) has the molecular formula C17H14F3NO4 and a molecular weight of 353.30 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 46613009 |
| Molecular Formula | C17H14F3NO4 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-(trifluoromethoxy)benzamide |
| SMILES | O=C(NCCc1ccc2c(c1)OCO2)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H14F3NO4/c18-17(19,20)25-13-4-2-12(3-5-13)16(22)21-8-7-11-1-6-14-15(9-11)24-10-23-14/h1-6,9H,7-8,10H2,(H,21,22) |
| InChIKey | FBWBFHSFQGALNY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |