C15H23N3O4 — CID 154773996
1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-3-[2-(dimethylamino)propyl]urea (PubChem CID 154773996) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-3-[2-(dimethylamino)propyl]urea.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-3-[2-(dimethylamino)propyl]urea |
|---|---|
| PubChem CID | 154773996 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yloxy)ethyl]-3-[2-(dimethylamino)propyl]urea |
| SMILES | CC(CNC(=O)NCCOc1ccc2c(c1)OCO2)N(C)C |
| InChI | InChI=1S/C15H23N3O4/c1-11(18(2)3)9-17-15(19)16-6-7-20-12-4-5-13-14(8-12)22-10-21-13/h4-5,8,11H,6-7,9-10H2,1-3H3,(H2,16,17,19) |
| InChIKey | XMEZVPLIRRQXPN-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|