C17H20ClNO3 — CID 52526472
1-(4-chlorophenyl)-N-[(2,3,4-trimethoxyphenyl)methyl]methanamine (PubChem CID 52526472) has the molecular formula C17H20ClNO3 and a molecular weight of 321.80 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[(2,3,4-trimethoxyphenyl)methyl]methanamine.
| Compound Name | 1-(4-chlorophenyl)-N-[(2,3,4-trimethoxyphenyl)methyl]methanamine |
|---|---|
| PubChem CID | 52526472 |
| Molecular Formula | C17H20ClNO3 |
| Molecular Weight | 321.80 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[(2,3,4-trimethoxyphenyl)methyl]methanamine |
| SMILES | COc1ccc(CNCc2ccc(Cl)cc2)c(OC)c1OC |
| InChI | InChI=1S/C17H20ClNO3/c1-20-15-9-6-13(16(21-2)17(15)22-3)11-19-10-12-4-7-14(18)8-5-12/h4-9,19H,10-11H2,1-3H3 |
| InChIKey | PDOMIZLFJVHRMF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.80 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |