C19H23NO4 — CID 18111151
3-(3,5-dimethoxyphenyl)-N-(2-phenoxyethyl)propanamide (PubChem CID 18111151) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is 3-(3,5-dimethoxyphenyl)-N-(2-phenoxyethyl)propanamide.
| Compound Name | 3-(3,5-dimethoxyphenyl)-N-(2-phenoxyethyl)propanamide |
|---|---|
| PubChem CID | 18111151 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 3-(3,5-dimethoxyphenyl)-N-(2-phenoxyethyl)propanamide |
| SMILES | COc1cc(CCC(=O)NCCOc2ccccc2)cc(OC)c1 |
| InChI | InChI=1S/C19H23NO4/c1-22-17-12-15(13-18(14-17)23-2)8-9-19(21)20-10-11-24-16-6-4-3-5-7-16/h3-7,12-14H,8-11H2,1-2H3,(H,20,21) |
| InChIKey | BROPXOCRKGFIAQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|