C23H24ClNO3 — CID 66529102
N-[(2-chloro-5-methoxy-4-phenylmethoxyphenyl)methyl]-1-(4-methoxyphenyl)methanamine (PubChem CID 66529102) has the molecular formula C23H24ClNO3 and a molecular weight of 397.90 g/mol. Its IUPAC name is N-[(2-chloro-5-methoxy-4-phenylmethoxyphenyl)methyl]-1-(4-methoxyphenyl)methanamine.
| Compound Name | N-[(2-chloro-5-methoxy-4-phenylmethoxyphenyl)methyl]-1-(4-methoxyphenyl)methanamine |
|---|---|
| PubChem CID | 66529102 |
| Molecular Formula | C23H24ClNO3 |
| Molecular Weight | 397.90 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | N-[(2-chloro-5-methoxy-4-phenylmethoxyphenyl)methyl]-1-(4-methoxyphenyl)methanamine |
| SMILES | COc1ccc(CNCc2cc(OC)c(OCc3ccccc3)cc2Cl)cc1 |
| InChI | InChI=1S/C23H24ClNO3/c1-26-20-10-8-17(9-11-20)14-25-15-19-12-22(27-2)23(13-21(19)24)28-16-18-6-4-3-5-7-18/h3-13,25H,14-16H2,1-2H3 |
| InChIKey | WUENYEYKMZIFBM-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.90 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |