C19H23Cl2NO — CID 17289738
N-[(5-chloro-2-phenylmethoxyphenyl)methyl]cyclopentanamine;hydrochloride (PubChem CID 17289738) has the molecular formula C19H23Cl2NO and a molecular weight of 352.31 g/mol. Its IUPAC name is N-[(5-chloro-2-phenylmethoxyphenyl)methyl]cyclopentanamine;hydrochloride.
| Compound Name | N-[(5-chloro-2-phenylmethoxyphenyl)methyl]cyclopentanamine;hydrochloride |
|---|---|
| PubChem CID | 17289738 |
| Molecular Formula | C19H23Cl2NO |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | N-[(5-chloro-2-phenylmethoxyphenyl)methyl]cyclopentanamine;hydrochloride |
| SMILES | Cl.Clc1ccc(OCc2ccccc2)c(CNC2CCCC2)c1 |
| InChI | InChI=1S/C19H22ClNO.ClH/c20-17-10-11-19(22-14-15-6-2-1-3-7-15)16(12-17)13-21-18-8-4-5-9-18;/h1-3,6-7,10-12,18,21H,4-5,8-9,13-14H2;1H |
| InChIKey | PHNHVWGLIUKMMX-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |