C19H22Cl2FNO — CID 2950069
N-[[5-chloro-2-[(2-fluorophenyl)methoxy]phenyl]methyl]cyclopentanamine;hydrochloride (PubChem CID 2950069) has the molecular formula C19H22Cl2FNO and a molecular weight of 370.30 g/mol. Its IUPAC name is N-[[5-chloro-2-[(2-fluorophenyl)methoxy]phenyl]methyl]cyclopentanamine;hydrochloride.
| Compound Name | N-[[5-chloro-2-[(2-fluorophenyl)methoxy]phenyl]methyl]cyclopentanamine;hydrochloride |
|---|---|
| PubChem CID | 2950069 |
| Molecular Formula | C19H22Cl2FNO |
| Molecular Weight | 370.30 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | N-[[5-chloro-2-[(2-fluorophenyl)methoxy]phenyl]methyl]cyclopentanamine;hydrochloride |
| SMILES | Cl.Fc1ccccc1COc1ccc(Cl)cc1CNC1CCCC1 |
| InChI | InChI=1S/C19H21ClFNO.ClH/c20-16-9-10-19(23-13-14-5-1-4-8-18(14)21)15(11-16)12-22-17-6-2-3-7-17;/h1,4-5,8-11,17,22H,2-3,6-7,12-13H2;1H |
| InChIKey | YKYCTLVAASQWQP-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.30 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |