C20H27Cl2NO3 — CID 17211831
5-[(5-chloro-3-methoxy-2-phenylmethoxyphenyl)methylamino]pentan-1-ol;hydrochloride (PubChem CID 17211831) has the molecular formula C20H27Cl2NO3 and a molecular weight of 400.35 g/mol. Its IUPAC name is 5-[(5-chloro-3-methoxy-2-phenylmethoxyphenyl)methylamino]pentan-1-ol;hydrochloride.
| Compound Name | 5-[(5-chloro-3-methoxy-2-phenylmethoxyphenyl)methylamino]pentan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 17211831 |
| Molecular Formula | C20H27Cl2NO3 |
| Molecular Weight | 400.35 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 5-[(5-chloro-3-methoxy-2-phenylmethoxyphenyl)methylamino]pentan-1-ol;hydrochloride |
| SMILES | COc1cc(Cl)cc(CNCCCCCO)c1OCc1ccccc1.Cl |
| InChI | InChI=1S/C20H26ClNO3.ClH/c1-24-19-13-18(21)12-17(14-22-10-6-3-7-11-23)20(19)25-15-16-8-4-2-5-9-16;/h2,4-5,8-9,12-13,22-23H,3,6-7,10-11,14-15H2,1H3;1H |
| InChIKey | ODEWCFRBKKTPCN-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.35 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|