C19H21NO4 — CID 3814252
phenyl N-[(3,4-dimethoxyphenyl)methyl]-N-prop-2-enylcarbamate (PubChem CID 3814252) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is phenyl N-[(3,4-dimethoxyphenyl)methyl]-N-prop-2-enylcarbamate.
| Compound Name | phenyl N-[(3,4-dimethoxyphenyl)methyl]-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 3814252 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | phenyl N-[(3,4-dimethoxyphenyl)methyl]-N-prop-2-enylcarbamate |
| SMILES | C=CCN(Cc1ccc(OC)c(OC)c1)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C19H21NO4/c1-4-12-20(19(21)24-16-8-6-5-7-9-16)14-15-10-11-17(22-2)18(13-15)23-3/h4-11,13H,1,12,14H2,2-3H3 |
| InChIKey | NVVZDFPYLNFQEC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|