C23H26N2O5 — CID 4976318
N-[(3,4-dimethoxyphenyl)methyl]-5,6-dimethoxy-N-prop-2-enyl-1H-indole-2-carboxamide (PubChem CID 4976318) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-5,6-dimethoxy-N-prop-2-enyl-1H-indole-2-carboxamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-5,6-dimethoxy-N-prop-2-enyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 4976318 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-5,6-dimethoxy-N-prop-2-enyl-1H-indole-2-carboxamide |
| SMILES | C=CCN(Cc1ccc(OC)c(OC)c1)C(=O)c1cc2cc(OC)c(OC)cc2[nH]1 |
| InChI | InChI=1S/C23H26N2O5/c1-6-9-25(14-15-7-8-19(27-2)20(10-15)28-3)23(26)18-11-16-12-21(29-4)22(30-5)13-17(16)24-18/h6-8,10-13,24H,1,9,14H2,2-5H3 |
| InChIKey | SAKDIGXRYYLCNO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 73.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|