C22H22N2O4 — CID 132534514
[(E)-4-[benzyl(1H-indole-2-carbonyl)amino]but-2-enyl] methyl carbonate (PubChem CID 132534514) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is [(E)-4-[benzyl(1H-indole-2-carbonyl)amino]but-2-enyl] methyl carbonate.
| Compound Name | [(E)-4-[benzyl(1H-indole-2-carbonyl)amino]but-2-enyl] methyl carbonate |
|---|---|
| PubChem CID | 132534514 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | [(E)-4-[benzyl(1H-indole-2-carbonyl)amino]but-2-enyl] methyl carbonate |
| SMILES | COC(=O)OC/C=C/CN(Cc1ccccc1)C(=O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C22H22N2O4/c1-27-22(26)28-14-8-7-13-24(16-17-9-3-2-4-10-17)21(25)20-15-18-11-5-6-12-19(18)23-20/h2-12,15,23H,13-14,16H2,1H3/b8-7+ |
| InChIKey | FKFWWLVVVFVIGC-BQYQJAHWSA-N |
| XLogP | 4.15 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|