C22H23BrN2O3 — CID 73212000
[(E)-4-[benzyl-[(5-bromo-1H-indol-2-yl)methyl]amino]but-2-enyl] methyl carbonate (PubChem CID 73212000) has the molecular formula C22H23BrN2O3 and a molecular weight of 443.34 g/mol. Its IUPAC name is [(E)-4-[benzyl-[(5-bromo-1H-indol-2-yl)methyl]amino]but-2-enyl] methyl carbonate.
| Compound Name | [(E)-4-[benzyl-[(5-bromo-1H-indol-2-yl)methyl]amino]but-2-enyl] methyl carbonate |
|---|---|
| PubChem CID | 73212000 |
| Molecular Formula | C22H23BrN2O3 |
| Molecular Weight | 443.34 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | [(E)-4-[benzyl-[(5-bromo-1H-indol-2-yl)methyl]amino]but-2-enyl] methyl carbonate |
| SMILES | COC(=O)OC/C=C/CN(Cc1ccccc1)Cc1cc2cc(Br)ccc2[nH]1 |
| InChI | InChI=1S/C22H23BrN2O3/c1-27-22(26)28-12-6-5-11-25(15-17-7-3-2-4-8-17)16-20-14-18-13-19(23)9-10-21(18)24-20/h2-10,13-14,24H,11-12,15-16H2,1H3/b6-5+ |
| InChIKey | JNIAHJSMUKINLG-AATRIKPKSA-N |
| XLogP | 5.27 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.34 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|