C21H25NO5 — CID 135075238
[(E)-4-[benzyl-[(3-hydroxy-4-methoxyphenyl)methyl]amino]but-2-enyl] methyl carbonate (PubChem CID 135075238) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is [(E)-4-[benzyl-[(3-hydroxy-4-methoxyphenyl)methyl]amino]but-2-enyl] methyl carbonate.
| Compound Name | [(E)-4-[benzyl-[(3-hydroxy-4-methoxyphenyl)methyl]amino]but-2-enyl] methyl carbonate |
|---|---|
| PubChem CID | 135075238 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | [(E)-4-[benzyl-[(3-hydroxy-4-methoxyphenyl)methyl]amino]but-2-enyl] methyl carbonate |
| SMILES | COC(=O)OC/C=C/CN(Cc1ccccc1)Cc1ccc(OC)c(O)c1 |
| InChI | InChI=1S/C21H25NO5/c1-25-20-11-10-18(14-19(20)23)16-22(15-17-8-4-3-5-9-17)12-6-7-13-27-21(24)26-2/h3-11,14,23H,12-13,15-16H2,1-2H3/b7-6+ |
| InChIKey | YMBUQTAEICYQCR-VOTSOKGWSA-N |
| XLogP | 3.74 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|