C18H17F2NO2 — CID 58659677
phenyl N-[2-(3,5-difluorophenyl)ethyl]-N-prop-2-enylcarbamate (PubChem CID 58659677) has the molecular formula C18H17F2NO2 and a molecular weight of 317.33 g/mol. Its IUPAC name is phenyl N-[2-(3,5-difluorophenyl)ethyl]-N-prop-2-enylcarbamate.
| Compound Name | phenyl N-[2-(3,5-difluorophenyl)ethyl]-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 58659677 |
| Molecular Formula | C18H17F2NO2 |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | phenyl N-[2-(3,5-difluorophenyl)ethyl]-N-prop-2-enylcarbamate |
| SMILES | C=CCN(CCc1cc(F)cc(F)c1)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C18H17F2NO2/c1-2-9-21(18(22)23-17-6-4-3-5-7-17)10-8-14-11-15(19)13-16(20)12-14/h2-7,11-13H,1,8-10H2 |
| InChIKey | XZJIVMYYNJYWRA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|