C18H17F2NO — CID 86857535
2,6-difluoro-N-(2-phenylethyl)-N-prop-2-enylbenzamide (PubChem CID 86857535) has the molecular formula C18H17F2NO and a molecular weight of 301.34 g/mol. Its IUPAC name is 2,6-difluoro-N-(2-phenylethyl)-N-prop-2-enylbenzamide.
| Compound Name | 2,6-difluoro-N-(2-phenylethyl)-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 86857535 |
| Molecular Formula | C18H17F2NO |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2,6-difluoro-N-(2-phenylethyl)-N-prop-2-enylbenzamide |
| SMILES | C=CCN(CCc1ccccc1)C(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C18H17F2NO/c1-2-12-21(13-11-14-7-4-3-5-8-14)18(22)17-15(19)9-6-10-16(17)20/h2-10H,1,11-13H2 |
| InChIKey | DAQHWASTGJORBG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|