C21H19NO4 — CID 47064295
N-[(4-methoxyphenyl)methyl]-4-oxo-N-prop-2-enylchromene-2-carboxamide (PubChem CID 47064295) has the molecular formula C21H19NO4 and a molecular weight of 349.39 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-4-oxo-N-prop-2-enylchromene-2-carboxamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-4-oxo-N-prop-2-enylchromene-2-carboxamide |
|---|---|
| PubChem CID | 47064295 |
| Molecular Formula | C21H19NO4 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-4-oxo-N-prop-2-enylchromene-2-carboxamide |
| SMILES | C=CCN(Cc1ccc(OC)cc1)C(=O)c1cc(=O)c2ccccc2o1 |
| InChI | InChI=1S/C21H19NO4/c1-3-12-22(14-15-8-10-16(25-2)11-9-15)21(24)20-13-18(23)17-6-4-5-7-19(17)26-20/h3-11,13H,1,12,14H2,2H3 |
| InChIKey | HUVQUKSMKRCISD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|