C23H22FNO5 — CID 43843506
6-fluoro-N-[(4-methoxyphenyl)methyl]-4-oxo-N-(oxolan-2-ylmethyl)chromene-2-carboxamide (PubChem CID 43843506) has the molecular formula C23H22FNO5 and a molecular weight of 411.43 g/mol. Its IUPAC name is 6-fluoro-N-[(4-methoxyphenyl)methyl]-4-oxo-N-(oxolan-2-ylmethyl)chromene-2-carboxamide.
| Compound Name | 6-fluoro-N-[(4-methoxyphenyl)methyl]-4-oxo-N-(oxolan-2-ylmethyl)chromene-2-carboxamide |
|---|---|
| PubChem CID | 43843506 |
| Molecular Formula | C23H22FNO5 |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 6-fluoro-N-[(4-methoxyphenyl)methyl]-4-oxo-N-(oxolan-2-ylmethyl)chromene-2-carboxamide |
| SMILES | COc1ccc(CN(CC2CCCO2)C(=O)c2cc(=O)c3cc(F)ccc3o2)cc1 |
| InChI | InChI=1S/C23H22FNO5/c1-28-17-7-4-15(5-8-17)13-25(14-18-3-2-10-29-18)23(27)22-12-20(26)19-11-16(24)6-9-21(19)30-22/h4-9,11-12,18H,2-3,10,13-14H2,1H3 |
| InChIKey | BLKMWPSPTYKWHF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |