C20H18FNO5 — CID 35541191
6-fluoro-N-(furan-2-ylmethyl)-4-oxo-N-[[(2R)-oxolan-2-yl]methyl]chromene-2-carboxamide (PubChem CID 35541191) has the molecular formula C20H18FNO5 and a molecular weight of 371.36 g/mol. Its IUPAC name is 6-fluoro-N-(furan-2-ylmethyl)-4-oxo-N-[[(2R)-oxolan-2-yl]methyl]chromene-2-carboxamide.
| Compound Name | 6-fluoro-N-(furan-2-ylmethyl)-4-oxo-N-[[(2R)-oxolan-2-yl]methyl]chromene-2-carboxamide |
|---|---|
| PubChem CID | 35541191 |
| Molecular Formula | C20H18FNO5 |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 6-fluoro-N-(furan-2-ylmethyl)-4-oxo-N-[[(2R)-oxolan-2-yl]methyl]chromene-2-carboxamide |
| SMILES | O=C(c1cc(=O)c2cc(F)ccc2o1)N(Cc1ccco1)C[C@H]1CCCO1 |
| InChI | InChI=1S/C20H18FNO5/c21-13-5-6-18-16(9-13)17(23)10-19(27-18)20(24)22(11-14-3-1-7-25-14)12-15-4-2-8-26-15/h1,3,5-7,9-10,15H,2,4,8,11-12H2/t15-/m1/s1 |
| InChIKey | UIJGHWKMALITDZ-OAHLLOKOSA-N |
| XLogP | 3.35 |
| TPSA | 72.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |