C23H18FNO4 — CID 35342487
N-[(4-fluorophenyl)methyl]-N-(furan-2-ylmethyl)-6-methyl-4-oxochromene-2-carboxamide (PubChem CID 35342487) has the molecular formula C23H18FNO4 and a molecular weight of 391.40 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N-(furan-2-ylmethyl)-6-methyl-4-oxochromene-2-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-N-(furan-2-ylmethyl)-6-methyl-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 35342487 |
| Molecular Formula | C23H18FNO4 |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N-(furan-2-ylmethyl)-6-methyl-4-oxochromene-2-carboxamide |
| SMILES | Cc1ccc2oc(C(=O)N(Cc3ccc(F)cc3)Cc3ccco3)cc(=O)c2c1 |
| InChI | InChI=1S/C23H18FNO4/c1-15-4-9-21-19(11-15)20(26)12-22(29-21)23(27)25(14-18-3-2-10-28-18)13-16-5-7-17(24)8-6-16/h2-12H,13-14H2,1H3 |
| InChIKey | FCZPUEFSPOOPBQ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 63.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |