C22H19NO4S — CID 35181644
6-ethyl-N-(furan-2-ylmethyl)-4-oxo-N-(thiophen-2-ylmethyl)chromene-2-carboxamide (PubChem CID 35181644) has the molecular formula C22H19NO4S and a molecular weight of 393.46 g/mol. Its IUPAC name is 6-ethyl-N-(furan-2-ylmethyl)-4-oxo-N-(thiophen-2-ylmethyl)chromene-2-carboxamide.
| Compound Name | 6-ethyl-N-(furan-2-ylmethyl)-4-oxo-N-(thiophen-2-ylmethyl)chromene-2-carboxamide |
|---|---|
| PubChem CID | 35181644 |
| Molecular Formula | C22H19NO4S |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 6-ethyl-N-(furan-2-ylmethyl)-4-oxo-N-(thiophen-2-ylmethyl)chromene-2-carboxamide |
| SMILES | CCc1ccc2oc(C(=O)N(Cc3ccco3)Cc3cccs3)cc(=O)c2c1 |
| InChI | InChI=1S/C22H19NO4S/c1-2-15-7-8-20-18(11-15)19(24)12-21(27-20)22(25)23(13-16-5-3-9-26-16)14-17-6-4-10-28-17/h3-12H,2,13-14H2,1H3 |
| InChIKey | CVIHAQKSMLMBOV-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 63.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |