C20H19NO4S — CID 35541317
4-oxo-N-[[(2S)-oxolan-2-yl]methyl]-N-(thiophen-2-ylmethyl)chromene-2-carboxamide (PubChem CID 35541317) has the molecular formula C20H19NO4S and a molecular weight of 369.44 g/mol. Its IUPAC name is 4-oxo-N-[[(2S)-oxolan-2-yl]methyl]-N-(thiophen-2-ylmethyl)chromene-2-carboxamide.
| Compound Name | 4-oxo-N-[[(2S)-oxolan-2-yl]methyl]-N-(thiophen-2-ylmethyl)chromene-2-carboxamide |
|---|---|
| PubChem CID | 35541317 |
| Molecular Formula | C20H19NO4S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 4-oxo-N-[[(2S)-oxolan-2-yl]methyl]-N-(thiophen-2-ylmethyl)chromene-2-carboxamide |
| SMILES | O=C(c1cc(=O)c2ccccc2o1)N(Cc1cccs1)C[C@@H]1CCCO1 |
| InChI | InChI=1S/C20H19NO4S/c22-17-11-19(25-18-8-2-1-7-16(17)18)20(23)21(12-14-5-3-9-24-14)13-15-6-4-10-26-15/h1-2,4,6-8,10-11,14H,3,5,9,12-13H2/t14-/m0/s1 |
| InChIKey | FAQCDVXAVUOXOM-AWEZNQCLSA-N |
| XLogP | 3.68 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |