C17H17FO4 — CID 159966896
6-fluoro-2-[3-(oxan-2-yl)propanoyl]chromen-4-one (PubChem CID 159966896) has the molecular formula C17H17FO4 and a molecular weight of 304.32 g/mol. Its IUPAC name is 6-fluoro-2-[3-(oxan-2-yl)propanoyl]chromen-4-one.
| Compound Name | 6-fluoro-2-[3-(oxan-2-yl)propanoyl]chromen-4-one |
|---|---|
| PubChem CID | 159966896 |
| Molecular Formula | C17H17FO4 |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 6-fluoro-2-[3-(oxan-2-yl)propanoyl]chromen-4-one |
| SMILES | O=C(CCC1CCCCO1)c1cc(=O)c2cc(F)ccc2o1 |
| InChI | InChI=1S/C17H17FO4/c18-11-4-7-16-13(9-11)15(20)10-17(22-16)14(19)6-5-12-3-1-2-8-21-12/h4,7,9-10,12H,1-3,5-6,8H2 |
| InChIKey | OEAXEUDAWABEKZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |