C17H24N2O4 — CID 69494857
methyl (2S)-2-amino-5-[(4-methoxyphenyl)methyl-prop-2-enylamino]-5-oxopentanoate (PubChem CID 69494857) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is methyl (2S)-2-amino-5-[(4-methoxyphenyl)methyl-prop-2-enylamino]-5-oxopentanoate.
| Compound Name | methyl (2S)-2-amino-5-[(4-methoxyphenyl)methyl-prop-2-enylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 69494857 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | methyl (2S)-2-amino-5-[(4-methoxyphenyl)methyl-prop-2-enylamino]-5-oxopentanoate |
| SMILES | C=CCN(Cc1ccc(OC)cc1)C(=O)CC[C@H](N)C(=O)OC |
| InChI | InChI=1S/C17H24N2O4/c1-4-11-19(12-13-5-7-14(22-2)8-6-13)16(20)10-9-15(18)17(21)23-3/h4-8,15H,1,9-12,18H2,2-3H3/t15-/m0/s1 |
| InChIKey | CWMMMTXILVUTOQ-HNNXBMFYSA-N |
| XLogP | 1.49 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|