C27H40N2O4 — CID 168975874
N-[2-[bis[(4-methoxyphenyl)methyl]amino]-2-oxoethyl]-N-propylpropanamide;propane (PubChem CID 168975874) has the molecular formula C27H40N2O4 and a molecular weight of 456.63 g/mol. Its IUPAC name is N-[2-[bis[(4-methoxyphenyl)methyl]amino]-2-oxoethyl]-N-propylpropanamide;propane.
| Compound Name | N-[2-[bis[(4-methoxyphenyl)methyl]amino]-2-oxoethyl]-N-propylpropanamide;propane |
|---|---|
| PubChem CID | 168975874 |
| Molecular Formula | C27H40N2O4 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.30 |
| IUPAC Name | N-[2-[bis[(4-methoxyphenyl)methyl]amino]-2-oxoethyl]-N-propylpropanamide;propane |
| SMILES | CCC.CCCN(CC(=O)N(Cc1ccc(OC)cc1)Cc1ccc(OC)cc1)C(=O)CC |
| InChI | InChI=1S/C24H32N2O4.C3H8/c1-5-15-25(23(27)6-2)18-24(28)26(16-19-7-11-21(29-3)12-8-19)17-20-9-13-22(30-4)14-10-20;1-3-2/h7-14H,5-6,15-18H2,1-4H3;3H2,1-2H3 |
| InChIKey | KXCHOULGGZPHLH-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |