C16H23FN2O3 — CID 133213000
2-[(4-fluorophenyl)methyl-propanoylamino]-N-(2-methoxyethyl)propanamide (PubChem CID 133213000) has the molecular formula C16H23FN2O3 and a molecular weight of 310.37 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl-propanoylamino]-N-(2-methoxyethyl)propanamide.
| Compound Name | 2-[(4-fluorophenyl)methyl-propanoylamino]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 133213000 |
| Molecular Formula | C16H23FN2O3 |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl-propanoylamino]-N-(2-methoxyethyl)propanamide |
| SMILES | CCC(=O)N(Cc1ccc(F)cc1)C(C)C(=O)NCCOC |
| InChI | InChI=1S/C16H23FN2O3/c1-4-15(20)19(11-13-5-7-14(17)8-6-13)12(2)16(21)18-9-10-22-3/h5-8,12H,4,9-11H2,1-3H3,(H,18,21) |
| InChIKey | RXGYMYFVNZYYFV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|