C28H33N3O2S — CID 93129397
N-[4-(dimethylamino)-3-[[[(1R)-1-phenylethyl]-(2-thiophen-2-ylacetyl)amino]methyl]phenyl]cyclobutanecarboxamide (PubChem CID 93129397) has the molecular formula C28H33N3O2S and a molecular weight of 475.66 g/mol. Its IUPAC name is N-[4-(dimethylamino)-3-[[[(1R)-1-phenylethyl]-(2-thiophen-2-ylacetyl)amino]methyl]phenyl]cyclobutanecarboxamide.
| Compound Name | N-[4-(dimethylamino)-3-[[[(1R)-1-phenylethyl]-(2-thiophen-2-ylacetyl)amino]methyl]phenyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 93129397 |
| Molecular Formula | C28H33N3O2S |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | N-[4-(dimethylamino)-3-[[[(1R)-1-phenylethyl]-(2-thiophen-2-ylacetyl)amino]methyl]phenyl]cyclobutanecarboxamide |
| SMILES | C[C@H](c1ccccc1)N(Cc1cc(NC(=O)C2CCC2)ccc1N(C)C)C(=O)Cc1cccs1 |
| InChI | InChI=1S/C28H33N3O2S/c1-20(21-9-5-4-6-10-21)31(27(32)18-25-13-8-16-34-25)19-23-17-24(14-15-26(23)30(2)3)29-28(33)22-11-7-12-22/h4-6,8-10,13-17,20,22H,7,11-12,18-19H2,1-3H3,(H,29,33)/t20-/m1/s1 |
| InChIKey | UACSIDONDQSRDC-HXUWFJFHSA-N |
| XLogP | 5.89 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|