C23H28FNO4S — CID 71954865
[3-[[cyclopropylmethyl(3,3-dimethylbutanoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 71954865) has the molecular formula C23H28FNO4S and a molecular weight of 433.55 g/mol. Its IUPAC name is [3-[[cyclopropylmethyl(3,3-dimethylbutanoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [3-[[cyclopropylmethyl(3,3-dimethylbutanoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 71954865 |
| Molecular Formula | C23H28FNO4S |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | [3-[[cyclopropylmethyl(3,3-dimethylbutanoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | CC(C)(C)CC(=O)N(Cc1cccc(OS(=O)(=O)c2ccc(F)cc2)c1)CC1CC1 |
| InChI | InChI=1S/C23H28FNO4S/c1-23(2,3)14-22(26)25(15-17-7-8-17)16-18-5-4-6-20(13-18)29-30(27,28)21-11-9-19(24)10-12-21/h4-6,9-13,17H,7-8,14-16H2,1-3H3 |
| InChIKey | RZNLTMKMXNQLAK-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|