C27H32FNO4S — CID 5170040
[3-[[adamantane-1-carbonyl(propan-2-yl)amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 5170040) has the molecular formula C27H32FNO4S and a molecular weight of 485.62 g/mol. Its IUPAC name is [3-[[adamantane-1-carbonyl(propan-2-yl)amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [3-[[adamantane-1-carbonyl(propan-2-yl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 5170040 |
| Molecular Formula | C27H32FNO4S |
| Molecular Weight | 485.62 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | [3-[[adamantane-1-carbonyl(propan-2-yl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | CC(C)N(Cc1cccc(OS(=O)(=O)c2ccc(F)cc2)c1)C(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C27H32FNO4S/c1-18(2)29(26(30)27-14-20-10-21(15-27)12-22(11-20)16-27)17-19-4-3-5-24(13-19)33-34(31,32)25-8-6-23(28)7-9-25/h3-9,13,18,20-22H,10-12,14-17H2,1-2H3 |
| InChIKey | RKLOVPNUDNSCQO-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.62 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|