C22H21BrO5S — CID 23257255
[2-[2-hydroxy-3-(4-methoxyphenyl)propyl]phenyl] 4-bromobenzenesulfonate (PubChem CID 23257255) has the molecular formula C22H21BrO5S and a molecular weight of 477.38 g/mol. Its IUPAC name is [2-[2-hydroxy-3-(4-methoxyphenyl)propyl]phenyl] 4-bromobenzenesulfonate.
| Compound Name | [2-[2-hydroxy-3-(4-methoxyphenyl)propyl]phenyl] 4-bromobenzenesulfonate |
|---|---|
| PubChem CID | 23257255 |
| Molecular Formula | C22H21BrO5S |
| Molecular Weight | 477.38 g/mol |
| Exact Mass | 476.03 |
| IUPAC Name | [2-[2-hydroxy-3-(4-methoxyphenyl)propyl]phenyl] 4-bromobenzenesulfonate |
| SMILES | COc1ccc(CC(O)Cc2ccccc2OS(=O)(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C22H21BrO5S/c1-27-20-10-6-16(7-11-20)14-19(24)15-17-4-2-3-5-22(17)28-29(25,26)21-12-8-18(23)9-13-21/h2-13,19,24H,14-15H2,1H3 |
| InChIKey | HPGAHQWXJPWYAA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|