C22H29NO5 — CID 70806375
ethyl (2R)-2-[3-[[3-(4-methoxyphenoxy)propylamino]methyl]phenoxy]propanoate (PubChem CID 70806375) has the molecular formula C22H29NO5 and a molecular weight of 387.48 g/mol. Its IUPAC name is ethyl (2R)-2-[3-[[3-(4-methoxyphenoxy)propylamino]methyl]phenoxy]propanoate.
| Compound Name | ethyl (2R)-2-[3-[[3-(4-methoxyphenoxy)propylamino]methyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 70806375 |
| Molecular Formula | C22H29NO5 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | ethyl (2R)-2-[3-[[3-(4-methoxyphenoxy)propylamino]methyl]phenoxy]propanoate |
| SMILES | CCOC(=O)[C@@H](C)Oc1cccc(CNCCCOc2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C22H29NO5/c1-4-26-22(24)17(2)28-21-8-5-7-18(15-21)16-23-13-6-14-27-20-11-9-19(25-3)10-12-20/h5,7-12,15,17,23H,4,6,13-14,16H2,1-3H3/t17-/m1/s1 |
| InChIKey | REBKPVMEPVGYMD-QGZVFWFLSA-N |
| XLogP | 3.58 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|