C22H29NO5 — CID 70806499
2-[3-[2-[3-(4-methoxyphenoxy)propylamino]ethyl]phenoxy]butanoic acid (PubChem CID 70806499) has the molecular formula C22H29NO5 and a molecular weight of 387.48 g/mol. Its IUPAC name is 2-[3-[2-[3-(4-methoxyphenoxy)propylamino]ethyl]phenoxy]butanoic acid.
| Compound Name | 2-[3-[2-[3-(4-methoxyphenoxy)propylamino]ethyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 70806499 |
| Molecular Formula | C22H29NO5 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | 2-[3-[2-[3-(4-methoxyphenoxy)propylamino]ethyl]phenoxy]butanoic acid |
| SMILES | CCC(Oc1cccc(CCNCCCOc2ccc(OC)cc2)c1)C(=O)O |
| InChI | InChI=1S/C22H29NO5/c1-3-21(22(24)25)28-20-7-4-6-17(16-20)12-14-23-13-5-15-27-19-10-8-18(26-2)9-11-19/h4,6-11,16,21,23H,3,5,12-15H2,1-2H3,(H,24,25) |
| InChIKey | CQHVNDFFTGIESR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|