C25H32O8S — CID 131725059
tert-butyl 4-[4-[4-(3-methylsulfonyloxypropyl)phenoxy]-3-oxobutan-2-yl]oxybenzoate (PubChem CID 131725059) has the molecular formula C25H32O8S and a molecular weight of 492.59 g/mol. Its IUPAC name is tert-butyl 4-[4-[4-(3-methylsulfonyloxypropyl)phenoxy]-3-oxobutan-2-yl]oxybenzoate.
| Compound Name | tert-butyl 4-[4-[4-(3-methylsulfonyloxypropyl)phenoxy]-3-oxobutan-2-yl]oxybenzoate |
|---|---|
| PubChem CID | 131725059 |
| Molecular Formula | C25H32O8S |
| Molecular Weight | 492.59 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | tert-butyl 4-[4-[4-(3-methylsulfonyloxypropyl)phenoxy]-3-oxobutan-2-yl]oxybenzoate |
| SMILES | CC(Oc1ccc(C(=O)OC(C)(C)C)cc1)C(=O)COc1ccc(CCCOS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C25H32O8S/c1-18(32-22-14-10-20(11-15-22)24(27)33-25(2,3)4)23(26)17-30-21-12-8-19(9-13-21)7-6-16-31-34(5,28)29/h8-15,18H,6-7,16-17H2,1-5H3 |
| InChIKey | AXDVLYJEKMUWQO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.59 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|