C24H24N2O7S — CID 4847643
[2-(3-acetylanilino)-2-oxoethyl] 3-hydroxy-2-(naphthalen-2-ylsulfonylamino)butanoate (PubChem CID 4847643) has the molecular formula C24H24N2O7S and a molecular weight of 484.53 g/mol. Its IUPAC name is [2-(3-acetylanilino)-2-oxoethyl] 3-hydroxy-2-(naphthalen-2-ylsulfonylamino)butanoate.
| Compound Name | [2-(3-acetylanilino)-2-oxoethyl] 3-hydroxy-2-(naphthalen-2-ylsulfonylamino)butanoate |
|---|---|
| PubChem CID | 4847643 |
| Molecular Formula | C24H24N2O7S |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | [2-(3-acetylanilino)-2-oxoethyl] 3-hydroxy-2-(naphthalen-2-ylsulfonylamino)butanoate |
| SMILES | CC(=O)c1cccc(NC(=O)COC(=O)C(NS(=O)(=O)c2ccc3ccccc3c2)C(C)O)c1 |
| InChI | InChI=1S/C24H24N2O7S/c1-15(27)18-8-5-9-20(12-18)25-22(29)14-33-24(30)23(16(2)28)26-34(31,32)21-11-10-17-6-3-4-7-19(17)13-21/h3-13,16,23,26,28H,14H2,1-2H3,(H,25,29) |
| InChIKey | SWJDUSGSRSVWRC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 138.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |