C21H25ClN2O5 — CID 40556056
[2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxylate (PubChem CID 40556056) has the molecular formula C21H25ClN2O5 and a molecular weight of 420.89 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxylate.
| Compound Name | [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 40556056 |
| Molecular Formula | C21H25ClN2O5 |
| Molecular Weight | 420.89 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | [2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] 1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxylate |
| SMILES | COc1ccc(Cl)cc1-n1c(C)cc(C(=O)OCC(=O)NC[C@H]2CCCO2)c1C |
| InChI | InChI=1S/C21H25ClN2O5/c1-13-9-17(14(2)24(13)18-10-15(22)6-7-19(18)27-3)21(26)29-12-20(25)23-11-16-5-4-8-28-16/h6-7,9-10,16H,4-5,8,11-12H2,1-3H3,(H,23,25)/t16-/m1/s1 |
| InChIKey | OVEVUGVYXMEOJI-MRXNPFEDSA-N |
| XLogP | 3.21 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.89 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|