C19H19BrClN3O6S — CID 3499300
N-[[[2-(2-bromo-4-chlorophenoxy)acetyl]amino]carbamothioyl]-3,4,5-trimethoxybenzamide (PubChem CID 3499300) has the molecular formula C19H19BrClN3O6S and a molecular weight of 532.80 g/mol. Its IUPAC name is N-[[[2-(2-bromo-4-chlorophenoxy)acetyl]amino]carbamothioyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[[[2-(2-bromo-4-chlorophenoxy)acetyl]amino]carbamothioyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 3499300 |
| Molecular Formula | C19H19BrClN3O6S |
| Molecular Weight | 532.80 g/mol |
| Exact Mass | 530.99 |
| IUPAC Name | N-[[[2-(2-bromo-4-chlorophenoxy)acetyl]amino]carbamothioyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NC(=S)NNC(=O)COc2ccc(Cl)cc2Br)cc(OC)c1OC |
| InChI | InChI=1S/C19H19BrClN3O6S/c1-27-14-6-10(7-15(28-2)17(14)29-3)18(26)22-19(31)24-23-16(25)9-30-13-5-4-11(21)8-12(13)20/h4-8H,9H2,1-3H3,(H,23,25)(H2,22,24,26,31) |
| InChIKey | NHHQBVQGVMBOQH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 107.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.80 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|