C13H15BrClN3O3S — CID 4926464
N-[[[2-(2-bromo-4-chlorophenoxy)acetyl]amino]carbamothioyl]-2-methylpropanamide (PubChem CID 4926464) has the molecular formula C13H15BrClN3O3S and a molecular weight of 408.71 g/mol. Its IUPAC name is N-[[[2-(2-bromo-4-chlorophenoxy)acetyl]amino]carbamothioyl]-2-methylpropanamide.
| Compound Name | N-[[[2-(2-bromo-4-chlorophenoxy)acetyl]amino]carbamothioyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 4926464 |
| Molecular Formula | C13H15BrClN3O3S |
| Molecular Weight | 408.71 g/mol |
| Exact Mass | 406.97 |
| IUPAC Name | N-[[[2-(2-bromo-4-chlorophenoxy)acetyl]amino]carbamothioyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NC(=S)NNC(=O)COc1ccc(Cl)cc1Br |
| InChI | InChI=1S/C13H15BrClN3O3S/c1-7(2)12(20)16-13(22)18-17-11(19)6-21-10-4-3-8(15)5-9(10)14/h3-5,7H,6H2,1-2H3,(H,17,19)(H2,16,18,20,22) |
| InChIKey | ZLUXKGDMZNGZDL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.71 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|