C14H10Br2ClN3O4S — CID 4926419
5-bromo-N-[[[2-(2-bromo-4-chlorophenoxy)acetyl]amino]carbamothioyl]furan-2-carboxamide (PubChem CID 4926419) has the molecular formula C14H10Br2ClN3O4S and a molecular weight of 511.58 g/mol. Its IUPAC name is 5-bromo-N-[[[2-(2-bromo-4-chlorophenoxy)acetyl]amino]carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[[[2-(2-bromo-4-chlorophenoxy)acetyl]amino]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 4926419 |
| Molecular Formula | C14H10Br2ClN3O4S |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 508.84 |
| IUPAC Name | 5-bromo-N-[[[2-(2-bromo-4-chlorophenoxy)acetyl]amino]carbamothioyl]furan-2-carboxamide |
| SMILES | O=C(COc1ccc(Cl)cc1Br)NNC(=S)NC(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C14H10Br2ClN3O4S/c15-8-5-7(17)1-2-9(8)23-6-12(21)19-20-14(25)18-13(22)10-3-4-11(16)24-10/h1-5H,6H2,(H,19,21)(H2,18,20,22,25) |
| InChIKey | ZIOVLKYAEYFXBY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|