C19H21BrClNO3 — CID 46585246
2-(2-bromo-4-chlorophenoxy)-N-[[2-(propan-2-yloxymethyl)phenyl]methyl]acetamide (PubChem CID 46585246) has the molecular formula C19H21BrClNO3 and a molecular weight of 426.74 g/mol. Its IUPAC name is 2-(2-bromo-4-chlorophenoxy)-N-[[2-(propan-2-yloxymethyl)phenyl]methyl]acetamide.
| Compound Name | 2-(2-bromo-4-chlorophenoxy)-N-[[2-(propan-2-yloxymethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 46585246 |
| Molecular Formula | C19H21BrClNO3 |
| Molecular Weight | 426.74 g/mol |
| Exact Mass | 425.04 |
| IUPAC Name | 2-(2-bromo-4-chlorophenoxy)-N-[[2-(propan-2-yloxymethyl)phenyl]methyl]acetamide |
| SMILES | CC(C)OCc1ccccc1CNC(=O)COc1ccc(Cl)cc1Br |
| InChI | InChI=1S/C19H21BrClNO3/c1-13(2)24-11-15-6-4-3-5-14(15)10-22-19(23)12-25-18-8-7-16(21)9-17(18)20/h3-9,13H,10-12H2,1-2H3,(H,22,23) |
| InChIKey | HFLGVNJOSALMNL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.74 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |