C21H18Br2N2O4S — CID 4636278
2-(1,6-dibromonaphthalen-2-yl)oxy-N-[(2,5-dimethoxyphenyl)carbamothioyl]acetamide (PubChem CID 4636278) has the molecular formula C21H18Br2N2O4S and a molecular weight of 554.26 g/mol. Its IUPAC name is 2-(1,6-dibromonaphthalen-2-yl)oxy-N-[(2,5-dimethoxyphenyl)carbamothioyl]acetamide.
| Compound Name | 2-(1,6-dibromonaphthalen-2-yl)oxy-N-[(2,5-dimethoxyphenyl)carbamothioyl]acetamide |
|---|---|
| PubChem CID | 4636278 |
| Molecular Formula | C21H18Br2N2O4S |
| Molecular Weight | 554.26 g/mol |
| Exact Mass | 551.94 |
| IUPAC Name | 2-(1,6-dibromonaphthalen-2-yl)oxy-N-[(2,5-dimethoxyphenyl)carbamothioyl]acetamide |
| SMILES | COc1ccc(OC)c(NC(=S)NC(=O)COc2ccc3cc(Br)ccc3c2Br)c1 |
| InChI | InChI=1S/C21H18Br2N2O4S/c1-27-14-5-8-17(28-2)16(10-14)24-21(30)25-19(26)11-29-18-7-3-12-9-13(22)4-6-15(12)20(18)23/h3-10H,11H2,1-2H3,(H2,24,25,26,30) |
| InChIKey | QCYUXMAGURPERO-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.26 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|