C18H19Br2N3O3S — CID 4923138
N-[[[2-(1,6-dibromonaphthalen-2-yl)oxyacetyl]amino]carbamothioyl]-3-methylbutanamide (PubChem CID 4923138) has the molecular formula C18H19Br2N3O3S and a molecular weight of 517.24 g/mol. Its IUPAC name is N-[[[2-(1,6-dibromonaphthalen-2-yl)oxyacetyl]amino]carbamothioyl]-3-methylbutanamide.
| Compound Name | N-[[[2-(1,6-dibromonaphthalen-2-yl)oxyacetyl]amino]carbamothioyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 4923138 |
| Molecular Formula | C18H19Br2N3O3S |
| Molecular Weight | 517.24 g/mol |
| Exact Mass | 514.95 |
| IUPAC Name | N-[[[2-(1,6-dibromonaphthalen-2-yl)oxyacetyl]amino]carbamothioyl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)NC(=S)NNC(=O)COc1ccc2cc(Br)ccc2c1Br |
| InChI | InChI=1S/C18H19Br2N3O3S/c1-10(2)7-15(24)21-18(27)23-22-16(25)9-26-14-6-3-11-8-12(19)4-5-13(11)17(14)20/h3-6,8,10H,7,9H2,1-2H3,(H,22,25)(H2,21,23,24,27) |
| InChIKey | GCEBUXGHAAICQN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.24 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|