C22H16Br2N4O5S — CID 17187389
(E)-N-[[[2-(1,6-dibromonaphthalen-2-yl)oxyacetyl]amino]carbamothioyl]-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 17187389) has the molecular formula C22H16Br2N4O5S and a molecular weight of 608.27 g/mol. Its IUPAC name is (E)-N-[[[2-(1,6-dibromonaphthalen-2-yl)oxyacetyl]amino]carbamothioyl]-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[[[2-(1,6-dibromonaphthalen-2-yl)oxyacetyl]amino]carbamothioyl]-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17187389 |
| Molecular Formula | C22H16Br2N4O5S |
| Molecular Weight | 608.27 g/mol |
| Exact Mass | 605.92 |
| IUPAC Name | (E)-N-[[[2-(1,6-dibromonaphthalen-2-yl)oxyacetyl]amino]carbamothioyl]-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])cc1)NC(=S)NNC(=O)COc1ccc2cc(Br)ccc2c1Br |
| InChI | InChI=1S/C22H16Br2N4O5S/c23-15-5-8-17-14(11-15)4-9-18(21(17)24)33-12-20(30)26-27-22(34)25-19(29)10-3-13-1-6-16(7-2-13)28(31)32/h1-11H,12H2,(H,26,30)(H2,25,27,29,34)/b10-3+ |
| InChIKey | YXYWRCQGUHQTFE-XCVCLJGOSA-N |
| XLogP | 4.39 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.27 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|