C20H15Br2N3O4S — CID 6134934
(E)-N-[[[2-(1,6-dibromonaphthalen-2-yl)oxyacetyl]amino]carbamothioyl]-3-(furan-2-yl)prop-2-enamide (PubChem CID 6134934) has the molecular formula C20H15Br2N3O4S and a molecular weight of 553.23 g/mol. Its IUPAC name is (E)-N-[[[2-(1,6-dibromonaphthalen-2-yl)oxyacetyl]amino]carbamothioyl]-3-(furan-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[[[2-(1,6-dibromonaphthalen-2-yl)oxyacetyl]amino]carbamothioyl]-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 6134934 |
| Molecular Formula | C20H15Br2N3O4S |
| Molecular Weight | 553.23 g/mol |
| Exact Mass | 550.92 |
| IUPAC Name | (E)-N-[[[2-(1,6-dibromonaphthalen-2-yl)oxyacetyl]amino]carbamothioyl]-3-(furan-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccco1)NC(=S)NNC(=O)COc1ccc2cc(Br)ccc2c1Br |
| InChI | InChI=1S/C20H15Br2N3O4S/c21-13-4-6-15-12(10-13)3-7-16(19(15)22)29-11-18(27)24-25-20(30)23-17(26)8-5-14-2-1-9-28-14/h1-10H,11H2,(H,24,27)(H2,23,25,26,30)/b8-5+ |
| InChIKey | GFIVETJVCPSSAA-VMPITWQZSA-N |
| XLogP | 4.07 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.23 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|