C22H22Br2N2O4S — CID 3330697
2-(1,6-dibromonaphthalen-2-yl)oxy-N-[4-(diethylsulfamoyl)phenyl]acetamide (PubChem CID 3330697) has the molecular formula C22H22Br2N2O4S and a molecular weight of 570.30 g/mol. Its IUPAC name is 2-(1,6-dibromonaphthalen-2-yl)oxy-N-[4-(diethylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-(1,6-dibromonaphthalen-2-yl)oxy-N-[4-(diethylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 3330697 |
| Molecular Formula | C22H22Br2N2O4S |
| Molecular Weight | 570.30 g/mol |
| Exact Mass | 567.97 |
| IUPAC Name | 2-(1,6-dibromonaphthalen-2-yl)oxy-N-[4-(diethylsulfamoyl)phenyl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(=O)COc2ccc3cc(Br)ccc3c2Br)cc1 |
| InChI | InChI=1S/C22H22Br2N2O4S/c1-3-26(4-2)31(28,29)18-9-7-17(8-10-18)25-21(27)14-30-20-12-5-15-13-16(23)6-11-19(15)22(20)24/h5-13H,3-4,14H2,1-2H3,(H,25,27) |
| InChIKey | DMVMGSCKHJAAGC-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.30 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |