C25H25Br3N2O4 — CID 4959647
3-bromo-N'-[2-(1,6-dibromonaphthalen-2-yl)oxyacetyl]-4-hexoxybenzohydrazide (PubChem CID 4959647) has the molecular formula C25H25Br3N2O4 and a molecular weight of 657.20 g/mol. Its IUPAC name is 3-bromo-N'-[2-(1,6-dibromonaphthalen-2-yl)oxyacetyl]-4-hexoxybenzohydrazide.
| Compound Name | 3-bromo-N'-[2-(1,6-dibromonaphthalen-2-yl)oxyacetyl]-4-hexoxybenzohydrazide |
|---|---|
| PubChem CID | 4959647 |
| Molecular Formula | C25H25Br3N2O4 |
| Molecular Weight | 657.20 g/mol |
| Exact Mass | 653.94 |
| IUPAC Name | 3-bromo-N'-[2-(1,6-dibromonaphthalen-2-yl)oxyacetyl]-4-hexoxybenzohydrazide |
| SMILES | CCCCCCOc1ccc(C(=O)NNC(=O)COc2ccc3cc(Br)ccc3c2Br)cc1Br |
| InChI | InChI=1S/C25H25Br3N2O4/c1-2-3-4-5-12-33-21-10-7-17(14-20(21)27)25(32)30-29-23(31)15-34-22-11-6-16-13-18(26)8-9-19(16)24(22)28/h6-11,13-14H,2-5,12,15H2,1H3,(H,29,31)(H,30,32) |
| InChIKey | BZSZCDPOENJLOZ-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.20 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|