C24H24Br2N2O4 — CID 4935386
N'-[2-(1,6-dibromonaphthalen-2-yl)oxyacetyl]-4-pentoxybenzohydrazide (PubChem CID 4935386) has the molecular formula C24H24Br2N2O4 and a molecular weight of 564.27 g/mol. Its IUPAC name is N'-[2-(1,6-dibromonaphthalen-2-yl)oxyacetyl]-4-pentoxybenzohydrazide.
| Compound Name | N'-[2-(1,6-dibromonaphthalen-2-yl)oxyacetyl]-4-pentoxybenzohydrazide |
|---|---|
| PubChem CID | 4935386 |
| Molecular Formula | C24H24Br2N2O4 |
| Molecular Weight | 564.27 g/mol |
| Exact Mass | 562.01 |
| IUPAC Name | N'-[2-(1,6-dibromonaphthalen-2-yl)oxyacetyl]-4-pentoxybenzohydrazide |
| SMILES | CCCCCOc1ccc(C(=O)NNC(=O)COc2ccc3cc(Br)ccc3c2Br)cc1 |
| InChI | InChI=1S/C24H24Br2N2O4/c1-2-3-4-13-31-19-9-5-16(6-10-19)24(30)28-27-22(29)15-32-21-12-7-17-14-18(25)8-11-20(17)23(21)26/h5-12,14H,2-4,13,15H2,1H3,(H,27,29)(H,28,30) |
| InChIKey | IRTQVBSTPXFOHN-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.27 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|