C25H32BrN3O4S — CID 4982157
N-[[[2-(2-bromo-4-tert-butylphenoxy)acetyl]amino]carbamothioyl]-3-(3-methylbutoxy)benzamide (PubChem CID 4982157) has the molecular formula C25H32BrN3O4S and a molecular weight of 550.52 g/mol. Its IUPAC name is N-[[[2-(2-bromo-4-tert-butylphenoxy)acetyl]amino]carbamothioyl]-3-(3-methylbutoxy)benzamide.
| Compound Name | N-[[[2-(2-bromo-4-tert-butylphenoxy)acetyl]amino]carbamothioyl]-3-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 4982157 |
| Molecular Formula | C25H32BrN3O4S |
| Molecular Weight | 550.52 g/mol |
| Exact Mass | 549.13 |
| IUPAC Name | N-[[[2-(2-bromo-4-tert-butylphenoxy)acetyl]amino]carbamothioyl]-3-(3-methylbutoxy)benzamide |
| SMILES | CC(C)CCOc1cccc(C(=O)NC(=S)NNC(=O)COc2ccc(C(C)(C)C)cc2Br)c1 |
| InChI | InChI=1S/C25H32BrN3O4S/c1-16(2)11-12-32-19-8-6-7-17(13-19)23(31)27-24(34)29-28-22(30)15-33-21-10-9-18(14-20(21)26)25(3,4)5/h6-10,13-14,16H,11-12,15H2,1-5H3,(H,28,30)(H2,27,29,31,34) |
| InChIKey | SADZHQBJKZZYDA-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.52 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|